About tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole
tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole (PubChem CID 159823509) has the molecular formula C14H22ClFN2O2S
and a molecular weight of 336.86 g/mol. Its IUPAC name is tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole |
| PubChem CID | 159823509 |
| Molecular Formula | C14H22ClFN2O2S |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole |
| SMILES | CC(C)(C)OC=O.FC1(c2ncc(CCl)s2)CCNCC1 |
| InChI | InChI=1S/C9H12ClFN2S.C5H10O2/c10-5-7-6-13-8(14-7)9(11)1-3-12-4-2-9;1-5(2,3)7-4-6/h6,12H,1-5H2;4H,1-3H3 |
| InChIKey | NMNPLQTYGKLOMW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole?
The IUPAC name of tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole (CID 159823509) is tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole.
What is the SMILES notation for tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole?
The canonical SMILES for tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole is CC(C)(C)OC=O.FC1(c2ncc(CCl)s2)CCNCC1.
What is the InChIKey of tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole?
The InChIKey is NMNPLQTYGKLOMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClFN2S.C5H10O2/c10-5-7-6-13-8(14-7)9(11)1-3-12-4-2-9;1-5(2,3)7-4-6/h6,12H,1-5H2;4H,1-3H3.
What are the key properties of tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole?
tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole has a molecular weight of 336.86 g/mol, XLogP of 3.39, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;5-(chloromethyl)-2-(4-fluoropiperidin-4-yl)-1,3-thiazole is sourced from PubChem (CID 159823509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).