About 1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane
1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane (PubChem CID 159823791) has the molecular formula C24H35BrO2
and a molecular weight of 435.45 g/mol. Its IUPAC name is 1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane.
Molecular Properties
| Compound Name | 1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane |
| PubChem CID | 159823791 |
| Molecular Formula | C24H35BrO2 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane |
| SMILES | C1CO1.CC(C)(C)c1cccc(Br)c1.CC(C)(C)c1cccc(CCO)c1 |
| InChI | InChI=1S/C12H18O.C10H13Br.C2H4O/c1-12(2,3)11-6-4-5-10(9-11)7-8-13;1-10(2,3)8-5-4-6-9(11)7-8;1-2-3-1/h4-6,9,13H,7-8H2,1-3H3;4-7H,1-3H3;1-2H2 |
| InChIKey | NMONKCIEGVSOHE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane?
The IUPAC name of 1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane (CID 159823791) is 1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane.
What is the SMILES notation for 1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane?
The canonical SMILES for 1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane is C1CO1.CC(C)(C)c1cccc(Br)c1.CC(C)(C)c1cccc(CCO)c1.
What is the InChIKey of 1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane?
The InChIKey is NMONKCIEGVSOHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O.C10H13Br.C2H4O/c1-12(2,3)11-6-4-5-10(9-11)7-8-13;1-10(2,3)8-5-4-6-9(11)7-8;1-2-3-1/h4-6,9,13H,7-8H2,1-3H3;4-7H,1-3H3;1-2H2.
What are the key properties of 1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane?
1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane has a molecular weight of 435.45 g/mol, XLogP of 6.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3-tert-butylbenzene;2-(3-tert-butylphenyl)ethanol;oxirane is sourced from PubChem (CID 159823791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).