C12H10BBrCl2O2 — CID 159824022
1-bromo-4-chloro-2,3,5,6-tetradeuteriobenzene;(4-chloro-2,3,5,6-tetradeuteriophenyl)boronic acid (PubChem CID 159824022) has the molecular formula C12H10BBrCl2O2 and a molecular weight of 355.88 g/mol. Its IUPAC name is 1-bromo-4-chloro-2,3,5,6-tetradeuteriobenzene;(4-chloro-2,3,5,6-tetradeuteriophenyl)boronic acid.
| Compound Name | 1-bromo-4-chloro-2,3,5,6-tetradeuteriobenzene;(4-chloro-2,3,5,6-tetradeuteriophenyl)boronic acid |
|---|---|
| PubChem CID | 159824022 |
| Molecular Formula | C12H10BBrCl2O2 |
| Molecular Weight | 355.88 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 1-bromo-4-chloro-2,3,5,6-tetradeuteriobenzene;(4-chloro-2,3,5,6-tetradeuteriophenyl)boronic acid |
| SMILES | [2H]c1c([2H])c(B(O)O)c([2H])c([2H])c1Cl.[2H]c1c([2H])c(Br)c([2H])c([2H])c1Cl |
| InChI | InChI=1S/C6H6BClO2.C6H4BrCl/c8-6-3-1-5(2-4-6)7(9)10;7-5-1-3-6(8)4-2-5/h1-4,9-10H;1-4H/i2*1D,2D,3D,4D |
| InChIKey | NMPGLSODDUYUNA-QVJIRNCKSA-N |
| XLogP | 3.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.88 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|