C38H42N8O9S5 — CID 159824117
ethanesulfonic acid;bis(N-methyl-N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-2-(4-pyridin-2-ylphenyl)acetamide) (PubChem CID 159824117) has the molecular formula C38H42N8O9S5 and a molecular weight of 915.14 g/mol. Its IUPAC name is ethanesulfonic acid;bis(N-methyl-N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-2-(4-pyridin-2-ylphenyl)acetamide).
| Compound Name | ethanesulfonic acid;bis(N-methyl-N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-2-(4-pyridin-2-ylphenyl)acetamide) |
|---|---|
| PubChem CID | 159824117 |
| Molecular Formula | C38H42N8O9S5 |
| Molecular Weight | 915.14 g/mol |
| Exact Mass | 914.17 |
| IUPAC Name | ethanesulfonic acid;bis(N-methyl-N-(4-methyl-5-sulfamoyl-1,3-thiazol-2-yl)-2-(4-pyridin-2-ylphenyl)acetamide) |
| SMILES | CCS(=O)(=O)O.Cc1nc(N(C)C(=O)Cc2ccc(-c3ccccn3)cc2)sc1S(N)(=O)=O.Cc1nc(N(C)C(=O)Cc2ccc(-c3ccccn3)cc2)sc1S(N)(=O)=O |
| InChI | InChI=1S/2C18H18N4O3S2.C2H6O3S/c2*1-12-17(27(19,24)25)26-18(21-12)22(2)16(23)11-13-6-8-14(9-7-13)15-5-3-4-10-20-15;1-2-6(3,4)5/h2*3-10H,11H2,1-2H3,(H2,19,24,25);2H2,1H3,(H,3,4,5) |
| InChIKey | NMPMQLYEYJFQMZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 266.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 915.14 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|