About bromocyclopropane;1-bromocyclopropane-1-sulfonamide
bromocyclopropane;1-bromocyclopropane-1-sulfonamide (PubChem CID 159824822) has the molecular formula C6H11Br2NO2S
and a molecular weight of 321.03 g/mol. Its IUPAC name is bromocyclopropane;1-bromocyclopropane-1-sulfonamide.
Molecular Properties
| Compound Name | bromocyclopropane;1-bromocyclopropane-1-sulfonamide |
| PubChem CID | 159824822 |
| Molecular Formula | C6H11Br2NO2S |
| Molecular Weight | 321.03 g/mol |
| Exact Mass | 318.89 |
| IUPAC Name | bromocyclopropane;1-bromocyclopropane-1-sulfonamide |
| SMILES | BrC1CC1.NS(=O)(=O)C1(Br)CC1 |
| InChI | InChI=1S/C3H6BrNO2S.C3H5Br/c4-3(1-2-3)8(5,6)7;4-3-1-2-3/h1-2H2,(H2,5,6,7);3H,1-2H2 |
| InChIKey | NMRXBQBKUPRLRB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.03 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromocyclopropane;1-bromocyclopropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromocyclopropane;1-bromocyclopropane-1-sulfonamide?
The IUPAC name of bromocyclopropane;1-bromocyclopropane-1-sulfonamide (CID 159824822) is bromocyclopropane;1-bromocyclopropane-1-sulfonamide.
What is the SMILES notation for bromocyclopropane;1-bromocyclopropane-1-sulfonamide?
The canonical SMILES for bromocyclopropane;1-bromocyclopropane-1-sulfonamide is BrC1CC1.NS(=O)(=O)C1(Br)CC1.
What is the InChIKey of bromocyclopropane;1-bromocyclopropane-1-sulfonamide?
The InChIKey is NMRXBQBKUPRLRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6BrNO2S.C3H5Br/c4-3(1-2-3)8(5,6)7;4-3-1-2-3/h1-2H2,(H2,5,6,7);3H,1-2H2.
What are the key properties of bromocyclopropane;1-bromocyclopropane-1-sulfonamide?
bromocyclopropane;1-bromocyclopropane-1-sulfonamide has a molecular weight of 321.03 g/mol, XLogP of 1.70, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromocyclopropane;1-bromocyclopropane-1-sulfonamide is sourced from PubChem (CID 159824822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).