C10H12Cl8O4 — CID 159826780
1-chloropropan-2-yl 2,2,2-trichloroacetate;2-methyloxirane;2,2,2-trichloroacetyl chloride (PubChem CID 159826780) has the molecular formula C10H12Cl8O4 and a molecular weight of 479.83 g/mol. Its IUPAC name is 1-chloropropan-2-yl 2,2,2-trichloroacetate;2-methyloxirane;2,2,2-trichloroacetyl chloride.
| Compound Name | 1-chloropropan-2-yl 2,2,2-trichloroacetate;2-methyloxirane;2,2,2-trichloroacetyl chloride |
|---|---|
| PubChem CID | 159826780 |
| Molecular Formula | C10H12Cl8O4 |
| Molecular Weight | 479.83 g/mol |
| Exact Mass | 475.82 |
| IUPAC Name | 1-chloropropan-2-yl 2,2,2-trichloroacetate;2-methyloxirane;2,2,2-trichloroacetyl chloride |
| SMILES | CC(CCl)OC(=O)C(Cl)(Cl)Cl.CC1CO1.O=C(Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H6Cl4O2.C3H6O.C2Cl4O/c1-3(2-6)11-4(10)5(7,8)9;1-3-2-4-3;3-1(7)2(4,5)6/h3H,2H2,1H3;3H,2H2,1H3; |
| InChIKey | NMXZNYVTGRFSMZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.83 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|