C17H15N3O — CID 15982884
6-(3-aminopropyl)-1-oxo-2H-benzo[h]isoquinoline-9-carbonitrile (PubChem CID 15982884) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 6-(3-aminopropyl)-1-oxo-2H-benzo[h]isoquinoline-9-carbonitrile.
| Compound Name | 6-(3-aminopropyl)-1-oxo-2H-benzo[h]isoquinoline-9-carbonitrile |
|---|---|
| PubChem CID | 15982884 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 6-(3-aminopropyl)-1-oxo-2H-benzo[h]isoquinoline-9-carbonitrile |
| SMILES | N#Cc1ccc2c(CCCN)cc3cc[nH]c(=O)c3c2c1 |
| InChI | InChI=1S/C17H15N3O/c18-6-1-2-12-9-13-5-7-20-17(21)16(13)15-8-11(10-19)3-4-14(12)15/h3-5,7-9H,1-2,6,18H2,(H,20,21) |
| InChIKey | RMANQLBCCAYXTH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|