C25H34N2O3 — CID 15982937
methyl 2-[1'-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-oxospiro[indole-3,4'-piperidine]-1-yl]acetate (PubChem CID 15982937) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is methyl 2-[1'-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-oxospiro[indole-3,4'-piperidine]-1-yl]acetate.
| Compound Name | methyl 2-[1'-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-oxospiro[indole-3,4'-piperidine]-1-yl]acetate |
|---|---|
| PubChem CID | 15982937 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | methyl 2-[1'-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yl)-2-oxospiro[indole-3,4'-piperidine]-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)C2(CCN(C3CCC4CCCCC4C3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H34N2O3/c1-30-23(28)17-27-22-9-5-4-8-21(22)25(24(27)29)12-14-26(15-13-25)20-11-10-18-6-2-3-7-19(18)16-20/h4-5,8-9,18-20H,2-3,6-7,10-17H2,1H3 |
| InChIKey | GSLPZHCOJZRJIT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |