C16H16N2O4 — CID 159829994
(5S)-9-nitro-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol (PubChem CID 159829994) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is (5S)-9-nitro-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol.
| Compound Name | (5S)-9-nitro-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol |
|---|---|
| PubChem CID | 159829994 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | (5S)-9-nitro-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol |
| SMILES | O=[N+]([O-])c1c(O)c(O)cc2c1CCNC[C@H]2c1ccccc1 |
| InChI | InChI=1S/C16H16N2O4/c19-14-8-12-11(15(16(14)20)18(21)22)6-7-17-9-13(12)10-4-2-1-3-5-10/h1-5,8,13,17,19-20H,6-7,9H2/t13-/m0/s1 |
| InChIKey | HLMRYCLVBPSZNG-ZDUSSCGKSA-N |
| XLogP | 2.28 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|