C22H22ClN5O2S — CID 159831590
1-[1-[(3aS,6aR)-2-[[4-chloro-3-(1,3-thiazol-2-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-3-yl]ethanone (PubChem CID 159831590) has the molecular formula C22H22ClN5O2S and a molecular weight of 455.97 g/mol. Its IUPAC name is 1-[1-[(3aS,6aR)-2-[[4-chloro-3-(1,3-thiazol-2-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-3-yl]ethanone.
| Compound Name | 1-[1-[(3aS,6aR)-2-[[4-chloro-3-(1,3-thiazol-2-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-3-yl]ethanone |
|---|---|
| PubChem CID | 159831590 |
| Molecular Formula | C22H22ClN5O2S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 1-[1-[(3aS,6aR)-2-[[4-chloro-3-(1,3-thiazol-2-yl)phenyl]methyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]pyrazol-3-yl]ethanone |
| SMILES | CC(=O)c1ccn(C(=O)N2C[C@H]3CN(Cc4ccc(Cl)c(-c5nccs5)c4)C[C@H]3C2)n1 |
| InChI | InChI=1S/C22H22ClN5O2S/c1-14(29)20-4-6-28(25-20)22(30)27-12-16-10-26(11-17(16)13-27)9-15-2-3-19(23)18(8-15)21-24-5-7-31-21/h2-8,16-17H,9-13H2,1H3/t16-,17+ |
| InChIKey | HRBCMZJULYHFNB-CALCHBBNSA-N |
| XLogP | 3.89 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |