About 2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane
2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane (PubChem CID 159831915) has the molecular formula C18H22F6O2
and a molecular weight of 384.36 g/mol. Its IUPAC name is 2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane.
Molecular Properties
| Compound Name | 2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane |
| PubChem CID | 159831915 |
| Molecular Formula | C18H22F6O2 |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane |
| SMILES | CC(CCCOC1CCCCO1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H22F6O2/c1-12(5-4-8-26-16-6-2-3-7-25-16)13-9-14(17(19,20)21)11-15(10-13)18(22,23)24/h9-12,16H,2-8H2,1H3 |
| InChIKey | NNOJVLAKAPKWIY-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane?
The IUPAC name of 2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane (CID 159831915) is 2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane.
What is the SMILES notation for 2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane?
The canonical SMILES for 2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane is CC(CCCOC1CCCCO1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane?
The InChIKey is NNOJVLAKAPKWIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F6O2/c1-12(5-4-8-26-16-6-2-3-7-25-16)13-9-14(17(19,20)21)11-15(10-13)18(22,23)24/h9-12,16H,2-8H2,1H3.
What are the key properties of 2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane?
2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane has a molecular weight of 384.36 g/mol, XLogP of 6.15, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[3,5-bis(trifluoromethyl)phenyl]pentoxy]oxane is sourced from PubChem (CID 159831915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).