About [1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate
[1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate (PubChem CID 15983319) has the molecular formula C21H26ClNO2
and a molecular weight of 359.90 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate.
Molecular Properties
| Compound Name | [1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate |
| PubChem CID | 15983319 |
| Molecular Formula | C21H26ClNO2 |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | [1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OC(CCN(C)C)c2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C21H26ClNO2/c1-14-12-16(3)19(13-15(14)2)21(24)25-20(10-11-23(4)5)17-6-8-18(22)9-7-17/h6-9,12-13,20H,10-11H2,1-5H3 |
| InChIKey | PRHCORHYTJWCNC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate?
The IUPAC name of [1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate (CID 15983319) is [1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate.
What is the SMILES notation for [1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate?
The canonical SMILES for [1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate is Cc1cc(C)c(C(=O)OC(CCN(C)C)c2ccc(Cl)cc2)cc1C.
What is the InChIKey of [1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate?
The InChIKey is PRHCORHYTJWCNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26ClNO2/c1-14-12-16(3)19(13-15(14)2)21(24)25-20(10-11-23(4)5)17-6-8-18(22)9-7-17/h6-9,12-13,20H,10-11H2,1-5H3.
What are the key properties of [1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate?
[1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate has a molecular weight of 359.90 g/mol, XLogP of 5.12, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-chlorophenyl)-3-(dimethylamino)propyl] 2,4,5-trimethylbenzoate is sourced from PubChem (CID 15983319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).