About imidazolidine-1,3-diamine
imidazolidine-1,3-diamine (PubChem CID 159833403) has the molecular formula C3H10N4
and a molecular weight of 102.14 g/mol. Its IUPAC name is imidazolidine-1,3-diamine.
Molecular Properties
| Compound Name | imidazolidine-1,3-diamine |
| PubChem CID | 159833403 |
| Molecular Formula | C3H10N4 |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.09 |
| IUPAC Name | imidazolidine-1,3-diamine |
| SMILES | NN1CCN(N)C1 |
| InChI | InChI=1S/C3H10N4/c4-6-1-2-7(5)3-6/h1-5H2 |
| InChIKey | YJOBNZUZKQDASP-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze imidazolidine-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazolidine-1,3-diamine?
The IUPAC name of imidazolidine-1,3-diamine (CID 159833403) is imidazolidine-1,3-diamine.
What is the SMILES notation for imidazolidine-1,3-diamine?
The canonical SMILES for imidazolidine-1,3-diamine is NN1CCN(N)C1.
What is the InChIKey of imidazolidine-1,3-diamine?
The InChIKey is YJOBNZUZKQDASP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N4/c4-6-1-2-7(5)3-6/h1-5H2.
What are the key properties of imidazolidine-1,3-diamine?
imidazolidine-1,3-diamine has a molecular weight of 102.14 g/mol, XLogP of -1.69, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazolidine-1,3-diamine is sourced from PubChem (CID 159833403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).