C80H67B2BrCl2N6O4 — CID 159834107
1-bromo-3,5-dichlorobenzene;bis(2,4-diphenyl-6-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]phenyl]-1,3,5-triazine) (PubChem CID 159834107) has the molecular formula C80H67B2BrCl2N6O4 and a molecular weight of 1348.89 g/mol. Its IUPAC name is 1-bromo-3,5-dichlorobenzene;bis(2,4-diphenyl-6-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]phenyl]-1,3,5-triazine).
| Compound Name | 1-bromo-3,5-dichlorobenzene;bis(2,4-diphenyl-6-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]phenyl]-1,3,5-triazine) |
|---|---|
| PubChem CID | 159834107 |
| Molecular Formula | C80H67B2BrCl2N6O4 |
| Molecular Weight | 1348.89 g/mol |
| Exact Mass | 1346.40 |
| IUPAC Name | 1-bromo-3,5-dichlorobenzene;bis(2,4-diphenyl-6-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]phenyl]-1,3,5-triazine) |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)c3ccccc23)OC1(C)C.CC1(C)OB(c2ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)c3ccccc23)OC1(C)C.Clc1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/2C37H32BN3O2.C6H3BrCl2/c2*1-36(2)37(3,4)43-38(42-36)32-24-23-29(30-17-11-12-18-31(30)32)25-19-21-28(22-20-25)35-40-33(26-13-7-5-8-14-26)39-34(41-35)27-15-9-6-10-16-27;7-4-1-5(8)3-6(9)2-4/h2*5-24H,1-4H3;1-3H |
| InChIKey | NNVJPOAIQYTLMW-UHFFFAOYSA-N |
| XLogP | 19.74 |
| TPSA | 114.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 95 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1348.89 |
| LogP ≤ 5 | 19.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|