C22H31N3O — CID 15983457
N,N-diethyl-3-[(6-methyl-8-phenyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl)oxy]propan-1-amine (PubChem CID 15983457) has the molecular formula C22H31N3O and a molecular weight of 353.51 g/mol. Its IUPAC name is N,N-diethyl-3-[(6-methyl-8-phenyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl)oxy]propan-1-amine.
| Compound Name | N,N-diethyl-3-[(6-methyl-8-phenyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl)oxy]propan-1-amine |
|---|---|
| PubChem CID | 15983457 |
| Molecular Formula | C22H31N3O |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | N,N-diethyl-3-[(6-methyl-8-phenyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl)oxy]propan-1-amine |
| SMILES | CCN(CC)CCCOc1cc2c(cn1)C(c1ccccc1)CN(C)C2 |
| InChI | InChI=1S/C22H31N3O/c1-4-25(5-2)12-9-13-26-22-14-19-16-24(3)17-21(20(19)15-23-22)18-10-7-6-8-11-18/h6-8,10-11,14-15,21H,4-5,9,12-13,16-17H2,1-3H3 |
| InChIKey | MVPLENCWDAZKFW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|