About 4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine
4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine (PubChem CID 15983459) has the molecular formula C24H33N3O2
and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine |
| PubChem CID | 15983459 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine |
| SMILES | COc1ccc(C2CN(C)Cc3cc(OCCCN4CCCCC4)ncc32)cc1 |
| InChI | InChI=1S/C24H33N3O2/c1-26-17-20-15-24(29-14-6-13-27-11-4-3-5-12-27)25-16-22(20)23(18-26)19-7-9-21(28-2)10-8-19/h7-10,15-16,23H,3-6,11-14,17-18H2,1-2H3 |
| InChIKey | PRLJSGHDMGISHB-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine?
The IUPAC name of 4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine (CID 15983459) is 4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine.
What is the SMILES notation for 4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine?
The canonical SMILES for 4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine is COc1ccc(C2CN(C)Cc3cc(OCCCN4CCCCC4)ncc32)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine?
The InChIKey is PRLJSGHDMGISHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H33N3O2/c1-26-17-20-15-24(29-14-6-13-27-11-4-3-5-12-27)25-16-22(20)23(18-26)19-7-9-21(28-2)10-8-19/h7-10,15-16,23H,3-6,11-14,17-18H2,1-2H3.
What are the key properties of 4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine?
4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine has a molecular weight of 395.55 g/mol, XLogP of 3.92, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine is sourced from PubChem (CID 15983459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).