C20H24ClN3O3S — CID 159835402
1-(3-chloro-4-methylphenyl)-2-[2-(1-methylimidazol-4-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]ethanone (PubChem CID 159835402) has the molecular formula C20H24ClN3O3S and a molecular weight of 421.95 g/mol. Its IUPAC name is 1-(3-chloro-4-methylphenyl)-2-[2-(1-methylimidazol-4-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]ethanone.
| Compound Name | 1-(3-chloro-4-methylphenyl)-2-[2-(1-methylimidazol-4-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]ethanone |
|---|---|
| PubChem CID | 159835402 |
| Molecular Formula | C20H24ClN3O3S |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 1-(3-chloro-4-methylphenyl)-2-[2-(1-methylimidazol-4-yl)sulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]ethanone |
| SMILES | Cc1ccc(C(=O)CC2CCC3CN(S(=O)(=O)c4cn(C)cn4)CC23)cc1Cl |
| InChI | InChI=1S/C20H24ClN3O3S/c1-13-3-4-15(7-18(13)21)19(25)8-14-5-6-16-9-24(10-17(14)16)28(26,27)20-11-23(2)12-22-20/h3-4,7,11-12,14,16-17H,5-6,8-10H2,1-2H3 |
| InChIKey | OEUOOOGMOMTAPA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |