C9H21N6O8P — CID 159835587
[(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol;[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphate (PubChem CID 159835587) has the molecular formula C9H21N6O8P and a molecular weight of 372.28 g/mol. Its IUPAC name is [(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol;[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphate.
| Compound Name | [(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol;[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 159835587 |
| Molecular Formula | C9H21N6O8P |
| Molecular Weight | 372.28 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | [(4,6-diamino-1,3,5-triazin-2-yl)amino]methanol;[3-hydroxy-2,2-bis(hydroxymethyl)propyl] dihydrogen phosphate |
| SMILES | Nc1nc(N)nc(NCO)n1.O=P(O)(O)OCC(CO)(CO)CO |
| InChI | InChI=1S/C5H13O7P.C4H8N6O/c6-1-5(2-7,3-8)4-12-13(9,10)11;5-2-8-3(6)10-4(9-2)7-1-11/h6-8H,1-4H2,(H2,9,10,11);11H,1H2,(H5,5,6,7,8,9,10) |
| InChIKey | NOAISTYDOLEXNJ-UHFFFAOYSA-N |
| XLogP | -3.54 |
| TPSA | 250.42 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.28 |
| LogP ≤ 5 | -3.54 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|