C23H31N3O3 — CID 15983576
4-[3-[[8-(4-methoxyphenyl)-6-methyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl]oxy]propyl]morpholine (PubChem CID 15983576) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 4-[3-[[8-(4-methoxyphenyl)-6-methyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl]oxy]propyl]morpholine.
| Compound Name | 4-[3-[[8-(4-methoxyphenyl)-6-methyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl]oxy]propyl]morpholine |
|---|---|
| PubChem CID | 15983576 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 4-[3-[[8-(4-methoxyphenyl)-6-methyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl]oxy]propyl]morpholine |
| SMILES | COc1ccc(C2CN(C)Cc3cc(OCCCN4CCOCC4)ncc32)cc1 |
| InChI | InChI=1S/C23H31N3O3/c1-25-16-19-14-23(29-11-3-8-26-9-12-28-13-10-26)24-15-21(19)22(17-25)18-4-6-20(27-2)7-5-18/h4-7,14-15,22H,3,8-13,16-17H2,1-2H3 |
| InChIKey | XTZKOGDXCXHQKA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|