C24H33N3O2 — CID 15983578
4-(3-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine (PubChem CID 15983578) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine.
| Compound Name | 4-(3-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine |
|---|---|
| PubChem CID | 15983578 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | 4-(3-methoxyphenyl)-2-methyl-7-(3-piperidin-1-ylpropoxy)-3,4-dihydro-1H-2,6-naphthyridine |
| SMILES | COc1cccc(C2CN(C)Cc3cc(OCCCN4CCCCC4)ncc32)c1 |
| InChI | InChI=1S/C24H33N3O2/c1-26-17-20-15-24(29-13-7-12-27-10-4-3-5-11-27)25-16-22(20)23(18-26)19-8-6-9-21(14-19)28-2/h6,8-9,14-16,23H,3-5,7,10-13,17-18H2,1-2H3 |
| InChIKey | FINNTOGAVZWNGL-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|