C28H64N6O — CID 159836604
1,3-bis(2,2-dimethylpropyl)-5-methyl-1,3,5-triazinane;[2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol (PubChem CID 159836604) has the molecular formula C28H64N6O and a molecular weight of 500.86 g/mol. Its IUPAC name is 1,3-bis(2,2-dimethylpropyl)-5-methyl-1,3,5-triazinane;[2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol.
| Compound Name | 1,3-bis(2,2-dimethylpropyl)-5-methyl-1,3,5-triazinane;[2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol |
|---|---|
| PubChem CID | 159836604 |
| Molecular Formula | C28H64N6O |
| Molecular Weight | 500.86 g/mol |
| Exact Mass | 500.51 |
| IUPAC Name | 1,3-bis(2,2-dimethylpropyl)-5-methyl-1,3,5-triazinane;[2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol |
| SMILES | CN1CN(CC(C)(C)C)CN(CC(C)(C)C)C1.CNCN(CN(CO)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C14H33N3O.C14H31N3/c1-13(2,3)8-16(10-15-7)11-17(12-18)9-14(4,5)6;1-13(2,3)8-16-10-15(7)11-17(12-16)9-14(4,5)6/h15,18H,8-12H2,1-7H3;8-12H2,1-7H3 |
| InChIKey | NODPGFCVEARPFH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 48.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.86 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|