About [2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol
[2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol (PubChem CID 159836606) has the molecular formula C14H33N3O
and a molecular weight of 259.44 g/mol. Its IUPAC name is [2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol.
Molecular Properties
| Compound Name | [2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol |
| PubChem CID | 159836606 |
| Molecular Formula | C14H33N3O |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.26 |
| IUPAC Name | [2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol |
| SMILES | CNCN(CN(CO)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C14H33N3O/c1-13(2,3)8-16(10-15-7)11-17(12-18)9-14(4,5)6/h15,18H,8-12H2,1-7H3 |
| InChIKey | MGBPLIZVSBZGJT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol?
The IUPAC name of [2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol (CID 159836606) is [2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol.
What is the SMILES notation for [2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol?
The canonical SMILES for [2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol is CNCN(CN(CO)CC(C)(C)C)CC(C)(C)C.
What is the InChIKey of [2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol?
The InChIKey is MGBPLIZVSBZGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H33N3O/c1-13(2,3)8-16(10-15-7)11-17(12-18)9-14(4,5)6/h15,18H,8-12H2,1-7H3.
What are the key properties of [2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol?
[2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol has a molecular weight of 259.44 g/mol, XLogP of 1.77, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-dimethylpropyl-[[2,2-dimethylpropyl(methylaminomethyl)amino]methyl]amino]methanol is sourced from PubChem (CID 159836606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).