C23H29F2N3O2 — CID 15983704
7-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-methoxyphenyl)-1,2,3,4-tetrahydro-2,6-naphthyridine (PubChem CID 15983704) has the molecular formula C23H29F2N3O2 and a molecular weight of 417.50 g/mol. Its IUPAC name is 7-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-methoxyphenyl)-1,2,3,4-tetrahydro-2,6-naphthyridine.
| Compound Name | 7-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-methoxyphenyl)-1,2,3,4-tetrahydro-2,6-naphthyridine |
|---|---|
| PubChem CID | 15983704 |
| Molecular Formula | C23H29F2N3O2 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 7-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-methoxyphenyl)-1,2,3,4-tetrahydro-2,6-naphthyridine |
| SMILES | COc1ccc(C2CNCc3cc(OCCCN4CCC(F)(F)CC4)ncc32)cc1 |
| InChI | InChI=1S/C23H29F2N3O2/c1-29-19-5-3-17(4-6-19)20-15-26-14-18-13-22(27-16-21(18)20)30-12-2-9-28-10-7-23(24,25)8-11-28/h3-6,13,16,20,26H,2,7-12,14-15H2,1H3 |
| InChIKey | DFDDKQNUEMRMSJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|