C21H27Cl2N3O — CID 15983706
3-[[8-(3,4-dichlorophenyl)-5,6,7,8-tetrahydro-2,6-naphthyridin-3-yl]oxy]-N,N-diethylpropan-1-amine (PubChem CID 15983706) has the molecular formula C21H27Cl2N3O and a molecular weight of 408.37 g/mol. Its IUPAC name is 3-[[8-(3,4-dichlorophenyl)-5,6,7,8-tetrahydro-2,6-naphthyridin-3-yl]oxy]-N,N-diethylpropan-1-amine.
| Compound Name | 3-[[8-(3,4-dichlorophenyl)-5,6,7,8-tetrahydro-2,6-naphthyridin-3-yl]oxy]-N,N-diethylpropan-1-amine |
|---|---|
| PubChem CID | 15983706 |
| Molecular Formula | C21H27Cl2N3O |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 3-[[8-(3,4-dichlorophenyl)-5,6,7,8-tetrahydro-2,6-naphthyridin-3-yl]oxy]-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCOc1cc2c(cn1)C(c1ccc(Cl)c(Cl)c1)CNC2 |
| InChI | InChI=1S/C21H27Cl2N3O/c1-3-26(4-2)8-5-9-27-21-11-16-12-24-13-17(18(16)14-25-21)15-6-7-19(22)20(23)10-15/h6-7,10-11,14,17,24H,3-5,8-9,12-13H2,1-2H3 |
| InChIKey | JQKPNPNQXMEIDL-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|