C26H29F3N4O3 — CID 159837181
2-[2-[2-(cyclohexen-1-yl)-4-[3-(2-methoxyethylamino)prop-1-en-2-yl]phenyl]acetyl]-1H-imidazole-5-carbonitrile;2,2,2-trifluoroacetaldehyde (PubChem CID 159837181) has the molecular formula C26H29F3N4O3 and a molecular weight of 502.54 g/mol. Its IUPAC name is 2-[2-[2-(cyclohexen-1-yl)-4-[3-(2-methoxyethylamino)prop-1-en-2-yl]phenyl]acetyl]-1H-imidazole-5-carbonitrile;2,2,2-trifluoroacetaldehyde.
| Compound Name | 2-[2-[2-(cyclohexen-1-yl)-4-[3-(2-methoxyethylamino)prop-1-en-2-yl]phenyl]acetyl]-1H-imidazole-5-carbonitrile;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 159837181 |
| Molecular Formula | C26H29F3N4O3 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | 2-[2-[2-(cyclohexen-1-yl)-4-[3-(2-methoxyethylamino)prop-1-en-2-yl]phenyl]acetyl]-1H-imidazole-5-carbonitrile;2,2,2-trifluoroacetaldehyde |
| SMILES | C=C(CNCCOC)c1ccc(CC(=O)c2ncc(C#N)[nH]2)c(C2=CCCCC2)c1.O=CC(F)(F)F |
| InChI | InChI=1S/C24H28N4O2.C2HF3O/c1-17(15-26-10-11-30-2)19-8-9-20(22(12-19)18-6-4-3-5-7-18)13-23(29)24-27-16-21(14-25)28-24;3-2(4,5)1-6/h6,8-9,12,16,26H,1,3-5,7,10-11,13,15H2,2H3,(H,27,28);1H |
| InChIKey | NOFPBMSDUKENFJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|