C24H31F2N3O2 — CID 15983839
7-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-methoxyphenyl)-2-methyl-3,4-dihydro-1H-2,6-naphthyridine (PubChem CID 15983839) has the molecular formula C24H31F2N3O2 and a molecular weight of 431.53 g/mol. Its IUPAC name is 7-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-methoxyphenyl)-2-methyl-3,4-dihydro-1H-2,6-naphthyridine.
| Compound Name | 7-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-methoxyphenyl)-2-methyl-3,4-dihydro-1H-2,6-naphthyridine |
|---|---|
| PubChem CID | 15983839 |
| Molecular Formula | C24H31F2N3O2 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.24 |
| IUPAC Name | 7-[3-(4,4-difluoropiperidin-1-yl)propoxy]-4-(4-methoxyphenyl)-2-methyl-3,4-dihydro-1H-2,6-naphthyridine |
| SMILES | COc1ccc(C2CN(C)Cc3cc(OCCCN4CCC(F)(F)CC4)ncc32)cc1 |
| InChI | InChI=1S/C24H31F2N3O2/c1-28-16-19-14-23(31-13-3-10-29-11-8-24(25,26)9-12-29)27-15-21(19)22(17-28)18-4-6-20(30-2)7-5-18/h4-7,14-15,22H,3,8-13,16-17H2,1-2H3 |
| InChIKey | ZUWJCXYNKNLHGC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|