C23H33N3O2 — CID 15983840
N,N-diethyl-3-[[8-(4-methoxyphenyl)-6-methyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl]oxy]propan-1-amine (PubChem CID 15983840) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N,N-diethyl-3-[[8-(4-methoxyphenyl)-6-methyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl]oxy]propan-1-amine.
| Compound Name | N,N-diethyl-3-[[8-(4-methoxyphenyl)-6-methyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl]oxy]propan-1-amine |
|---|---|
| PubChem CID | 15983840 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | N,N-diethyl-3-[[8-(4-methoxyphenyl)-6-methyl-7,8-dihydro-5H-2,6-naphthyridin-3-yl]oxy]propan-1-amine |
| SMILES | CCN(CC)CCCOc1cc2c(cn1)C(c1ccc(OC)cc1)CN(C)C2 |
| InChI | InChI=1S/C23H33N3O2/c1-5-26(6-2)12-7-13-28-23-14-19-16-25(3)17-22(21(19)15-24-23)18-8-10-20(27-4)11-9-18/h8-11,14-15,22H,5-7,12-13,16-17H2,1-4H3 |
| InChIKey | ALZTYVXVRZIERJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 37.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|