C41H51F2N5O5 — CID 159838650
7-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1-isocyano-3,3,7-trimethyloctan-4-one;2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-2-methylpropan-1-amine;4-isocyano-2,2-dimethylbutanoic acid (PubChem CID 159838650) has the molecular formula C41H51F2N5O5 and a molecular weight of 731.89 g/mol. Its IUPAC name is 7-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1-isocyano-3,3,7-trimethyloctan-4-one;2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-2-methylpropan-1-amine;4-isocyano-2,2-dimethylbutanoic acid.
| Compound Name | 7-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1-isocyano-3,3,7-trimethyloctan-4-one;2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-2-methylpropan-1-amine;4-isocyano-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 159838650 |
| Molecular Formula | C41H51F2N5O5 |
| Molecular Weight | 731.89 g/mol |
| Exact Mass | 731.39 |
| IUPAC Name | 7-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-1-isocyano-3,3,7-trimethyloctan-4-one;2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-2-methylpropan-1-amine;4-isocyano-2,2-dimethylbutanoic acid |
| SMILES | CC(C)(CN)c1coc(-c2ccc(F)cc2)n1.[C-]#[N+]CCC(C)(C)C(=O)CCC(C)(C)c1coc(-c2ccc(F)cc2)n1.[C-]#[N+]CCC(C)(C)C(=O)O |
| InChI | InChI=1S/C21H25FN2O2.C13H15FN2O.C7H11NO2/c1-20(2,11-10-18(25)21(3,4)12-13-23-5)17-14-26-19(24-17)15-6-8-16(22)9-7-15;1-13(2,8-15)11-7-17-12(16-11)9-3-5-10(14)6-4-9;1-7(2,6(9)10)4-5-8-3/h6-9,14H,10-13H2,1-4H3;3-7H,8,15H2,1-2H3;4-5H2,1-2H3,(H,9,10) |
| InChIKey | NOKBPSZVPSKYNS-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 141.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.89 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|