C16H31Cl2N3O2 — CID 159838908
1-chloro-2,2,5,5-tetramethylimidazolidin-4-one;1-chloro-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 159838908) has the molecular formula C16H31Cl2N3O2 and a molecular weight of 368.35 g/mol. Its IUPAC name is 1-chloro-2,2,5,5-tetramethylimidazolidin-4-one;1-chloro-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-chloro-2,2,5,5-tetramethylimidazolidin-4-one;1-chloro-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 159838908 |
| Molecular Formula | C16H31Cl2N3O2 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 1-chloro-2,2,5,5-tetramethylimidazolidin-4-one;1-chloro-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1Cl.CC1(C)NC(=O)C(C)(C)N1Cl |
| InChI | InChI=1S/C9H18ClNO.C7H13ClN2O/c1-8(2)5-7(12)6-9(3,4)11(8)10;1-6(2)5(11)9-7(3,4)10(6)8/h7,12H,5-6H2,1-4H3;1-4H3,(H,9,11) |
| InChIKey | NOKWNFPAMBCLAF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|