C12H20ClF9N2O2S — CID 159840971
trimethyl-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonylamino)propyl]azanium chloride (PubChem CID 159840971) has the molecular formula C12H20ClF9N2O2S and a molecular weight of 462.81 g/mol. Its IUPAC name is trimethyl-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonylamino)propyl]azanium chloride.
| Compound Name | trimethyl-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonylamino)propyl]azanium chloride |
|---|---|
| PubChem CID | 159840971 |
| Molecular Formula | C12H20ClF9N2O2S |
| Molecular Weight | 462.81 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | trimethyl-[3-(3,3,4,4,5,5,6,6,6-nonafluorohexylsulfonylamino)propyl]azanium chloride |
| SMILES | C[N+](C)(C)CCCNS(=O)(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Cl-] |
| InChI | InChI=1S/C12H20F9N2O2S.ClH/c1-23(2,3)7-4-6-22-26(24,25)8-5-9(13,14)10(15,16)11(17,18)12(19,20)21;/h22H,4-8H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | IPZFWZKNDRWFFW-UHFFFAOYSA-M |
| XLogP | -0.14 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.81 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|