About N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide
N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide (PubChem CID 15984110) has the molecular formula C22H23N3O3
and a molecular weight of 377.44 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide.
Molecular Properties
| Compound Name | N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide |
| PubChem CID | 15984110 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide |
| SMILES | COc1ccc(NCc2ccc(C(=O)Nc3ccccc3N)cc2)cc1OC |
| InChI | InChI=1S/C22H23N3O3/c1-27-20-12-11-17(13-21(20)28-2)24-14-15-7-9-16(10-8-15)22(26)25-19-6-4-3-5-18(19)23/h3-13,24H,14,23H2,1-2H3,(H,25,26) |
| InChIKey | LMZMJYFRBVPBFO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide?
The IUPAC name of N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide (CID 15984110) is N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide.
What is the SMILES notation for N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide?
The canonical SMILES for N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide is COc1ccc(NCc2ccc(C(=O)Nc3ccccc3N)cc2)cc1OC.
What is the InChIKey of N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide?
The InChIKey is LMZMJYFRBVPBFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O3/c1-27-20-12-11-17(13-21(20)28-2)24-14-15-7-9-16(10-8-15)22(26)25-19-6-4-3-5-18(19)23/h3-13,24H,14,23H2,1-2H3,(H,25,26).
What are the key properties of N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide?
N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide has a molecular weight of 377.44 g/mol, XLogP of 4.15, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminophenyl)-4-[(3,4-dimethoxyanilino)methyl]benzamide is sourced from PubChem (CID 15984110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).