C16H21NO — CID 15984177
(7aR,10aR)-10-methylidene-4-prop-2-enyl-2,6,7,7a,8,9-hexahydro-1H-cyclopenta[e]quinolin-3-one (PubChem CID 15984177) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is (7aR,10aR)-10-methylidene-4-prop-2-enyl-2,6,7,7a,8,9-hexahydro-1H-cyclopenta[e]quinolin-3-one.
| Compound Name | (7aR,10aR)-10-methylidene-4-prop-2-enyl-2,6,7,7a,8,9-hexahydro-1H-cyclopenta[e]quinolin-3-one |
|---|---|
| PubChem CID | 15984177 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | (7aR,10aR)-10-methylidene-4-prop-2-enyl-2,6,7,7a,8,9-hexahydro-1H-cyclopenta[e]quinolin-3-one |
| SMILES | C=CCN1C(=O)CC[C@]23C(=C)CC[C@H]2CCC=C13 |
| InChI | InChI=1S/C16H21NO/c1-3-11-17-14-6-4-5-13-8-7-12(2)16(13,14)10-9-15(17)18/h3,6,13H,1-2,4-5,7-11H2/t13-,16+/m1/s1 |
| InChIKey | HQVMGZPVAZIGRN-CJNGLKHVSA-N |
| XLogP | 3.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|