C52H52N4O4 — CID 15984214
5,10,15,20-tetrakis(4-methoxyphenyl)-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin (PubChem CID 15984214) has the molecular formula C52H52N4O4 and a molecular weight of 797.01 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-methoxyphenyl)-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(4-methoxyphenyl)-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 15984214 |
| Molecular Formula | C52H52N4O4 |
| Molecular Weight | 797.01 g/mol |
| Exact Mass | 796.40 |
| IUPAC Name | 5,10,15,20-tetrakis(4-methoxyphenyl)-5,10,15,20-tetramethyl-21,22,23,24-tetrahydroporphyrin |
| SMILES | COc1ccc(C2(C)c3ccc([nH]3)C(C)(c3ccc(OC)cc3)c3ccc([nH]3)C(C)(c3ccc(OC)cc3)c3ccc([nH]3)C(C)(c3ccc(OC)cc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C52H52N4O4/c1-49(33-9-17-37(57-5)18-10-33)41-25-27-43(53-41)50(2,34-11-19-38(58-6)20-12-34)45-29-31-47(55-45)52(4,36-15-23-40(60-8)24-16-36)48-32-30-46(56-48)51(3,44-28-26-42(49)54-44)35-13-21-39(59-7)22-14-35/h9-32,53-56H,1-8H3 |
| InChIKey | WPMGBFBYQXVFDG-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.01 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |