C19H34O2Si — CID 15984226
(4aS,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-4a,8,8-trimethyl-3,4,5,8a-tetrahydro-2H-naphthalen-1-one (PubChem CID 15984226) has the molecular formula C19H34O2Si and a molecular weight of 322.57 g/mol. Its IUPAC name is (4aS,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-4a,8,8-trimethyl-3,4,5,8a-tetrahydro-2H-naphthalen-1-one.
| Compound Name | (4aS,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-4a,8,8-trimethyl-3,4,5,8a-tetrahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 15984226 |
| Molecular Formula | C19H34O2Si |
| Molecular Weight | 322.57 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | (4aS,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-4a,8,8-trimethyl-3,4,5,8a-tetrahydro-2H-naphthalen-1-one |
| SMILES | CC1(C)C=C(O[Si](C)(C)C(C)(C)C)C[C@]2(C)CCCC(=O)[C@H]12 |
| InChI | InChI=1S/C19H34O2Si/c1-17(2,3)22(7,8)21-14-12-18(4,5)16-15(20)10-9-11-19(16,6)13-14/h12,16H,9-11,13H2,1-8H3/t16-,19+/m1/s1 |
| InChIKey | BVWGUTUDNFDKDU-APWZRJJASA-N |
| XLogP | 5.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|