C32H14F6N4O4S2 — CID 159843049
2-[4,8-bis(3,5-difluoro-4-methylsulfonylphenyl)-6-(diisocyanomethylidene)-3,7-difluoro-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile (PubChem CID 159843049) has the molecular formula C32H14F6N4O4S2 and a molecular weight of 696.61 g/mol. Its IUPAC name is 2-[4,8-bis(3,5-difluoro-4-methylsulfonylphenyl)-6-(diisocyanomethylidene)-3,7-difluoro-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile.
| Compound Name | 2-[4,8-bis(3,5-difluoro-4-methylsulfonylphenyl)-6-(diisocyanomethylidene)-3,7-difluoro-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 159843049 |
| Molecular Formula | C32H14F6N4O4S2 |
| Molecular Weight | 696.61 g/mol |
| Exact Mass | 696.04 |
| IUPAC Name | 2-[4,8-bis(3,5-difluoro-4-methylsulfonylphenyl)-6-(diisocyanomethylidene)-3,7-difluoro-1,5-dihydro-s-indacen-2-ylidene]propanedinitrile |
| SMILES | [C-]#[N+]C([N+]#[C-])=C1Cc2c(-c3cc(F)c(S(C)(=O)=O)c(F)c3)c3c(c(-c4cc(F)c(S(C)(=O)=O)c(F)c4)c2=C1F)CC(=C(C#N)C#N)C=3F |
| InChI | InChI=1S/C32H14F6N4O4S2/c1-41-32(42-2)19-10-18-25(14-7-22(35)31(23(36)8-14)48(4,45)46)26-17(9-16(28(26)37)15(11-39)12-40)24(27(18)29(19)38)13-5-20(33)30(21(34)6-13)47(3,43)44/h5-8H,9-10H2,3-4H3 |
| InChIKey | FABPZRVBDOQTQQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 124.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|