About (5Z)-5-phenylsulfanylnona-5,8-dienenitrile
(5Z)-5-phenylsulfanylnona-5,8-dienenitrile (PubChem CID 15984358) has the molecular formula C15H17NS
and a molecular weight of 243.38 g/mol. Its IUPAC name is (5Z)-5-phenylsulfanylnona-5,8-dienenitrile.
Molecular Properties
| Compound Name | (5Z)-5-phenylsulfanylnona-5,8-dienenitrile |
| PubChem CID | 15984358 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (5Z)-5-phenylsulfanylnona-5,8-dienenitrile |
| SMILES | C=CC/C=C(/CCCC#N)Sc1ccccc1 |
| InChI | InChI=1S/C15H17NS/c1-2-3-9-14(12-7-8-13-16)17-15-10-5-4-6-11-15/h2,4-6,9-11H,1,3,7-8,12H2/b14-9- |
| InChIKey | DRIKFFBBJKCJJX-ZROIWOOFSA-N |
| XLogP | 4.93 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-5-phenylsulfanylnona-5,8-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-phenylsulfanylnona-5,8-dienenitrile?
The IUPAC name of (5Z)-5-phenylsulfanylnona-5,8-dienenitrile (CID 15984358) is (5Z)-5-phenylsulfanylnona-5,8-dienenitrile.
What is the SMILES notation for (5Z)-5-phenylsulfanylnona-5,8-dienenitrile?
The canonical SMILES for (5Z)-5-phenylsulfanylnona-5,8-dienenitrile is C=CC/C=C(/CCCC#N)Sc1ccccc1.
What is the InChIKey of (5Z)-5-phenylsulfanylnona-5,8-dienenitrile?
The InChIKey is DRIKFFBBJKCJJX-ZROIWOOFSA-N. The full InChI is InChI=1S/C15H17NS/c1-2-3-9-14(12-7-8-13-16)17-15-10-5-4-6-11-15/h2,4-6,9-11H,1,3,7-8,12H2/b14-9-.
What are the key properties of (5Z)-5-phenylsulfanylnona-5,8-dienenitrile?
(5Z)-5-phenylsulfanylnona-5,8-dienenitrile has a molecular weight of 243.38 g/mol, XLogP of 4.93, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-phenylsulfanylnona-5,8-dienenitrile is sourced from PubChem (CID 15984358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).