C27H40N4O3 — CID 15984478
(3S,5R)-N-cyclopropyl-5-(2,2-dimethylpropanoylamino)-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide (PubChem CID 15984478) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is (3S,5R)-N-cyclopropyl-5-(2,2-dimethylpropanoylamino)-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide.
| Compound Name | (3S,5R)-N-cyclopropyl-5-(2,2-dimethylpropanoylamino)-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 15984478 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | (3S,5R)-N-cyclopropyl-5-(2,2-dimethylpropanoylamino)-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3-carboxamide |
| SMILES | COCCCn1cc(CN(C(=O)[C@@H]2CNC[C@H](NC(=O)C(C)(C)C)C2)C2CC2)c2ccccc21 |
| InChI | InChI=1S/C27H40N4O3/c1-27(2,3)26(33)29-21-14-19(15-28-16-21)25(32)31(22-10-11-22)18-20-17-30(12-7-13-34-4)24-9-6-5-8-23(20)24/h5-6,8-9,17,19,21-22,28H,7,10-16,18H2,1-4H3,(H,29,33)/t19-,21+/m0/s1 |
| InChIKey | RTNKJPDXSNPCMI-PZJWPPBQSA-N |
| XLogP | 3.31 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|