C26H46OSi — CID 15984506
[3,3-dimethyl-2,4,6-tris(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-trimethylsilane (PubChem CID 15984506) has the molecular formula C26H46OSi and a molecular weight of 402.74 g/mol. Its IUPAC name is [3,3-dimethyl-2,4,6-tris(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-trimethylsilane.
| Compound Name | [3,3-dimethyl-2,4,6-tris(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 15984506 |
| Molecular Formula | C26H46OSi |
| Molecular Weight | 402.74 g/mol |
| Exact Mass | 402.33 |
| IUPAC Name | [3,3-dimethyl-2,4,6-tris(3-methylbut-2-enyl)cyclohexen-1-yl]oxy-trimethylsilane |
| SMILES | CC(C)=CCC1=C(O[Si](C)(C)C)C(CC=C(C)C)CC(CC=C(C)C)C1(C)C |
| InChI | InChI=1S/C26H46OSi/c1-19(2)12-15-22-18-23(16-13-20(3)4)26(7,8)24(17-14-21(5)6)25(22)27-28(9,10)11/h12-14,22-23H,15-18H2,1-11H3 |
| InChIKey | IHZFSDXSEMSNEG-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.74 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|