About CID 15984603
CID 15984603 (PubChem CID 15984603) has the molecular formula C42H47Cl2N5Ru
and a molecular weight of 793.85 g/mol.
Molecular Properties
| Compound Name | CID 15984603 |
| PubChem CID | 15984603 |
| Molecular Formula | C42H47Cl2N5Ru |
| Molecular Weight | 793.85 g/mol |
| Exact Mass | 793.23 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[C]N(c2cccc(N3[C]N(c4c(C(C)C)cccc4C(C)C)C=C3)n2)C=C1.Cl[Ru](Cl)=Cc1ccccc1 |
| InChI | InChI=1S/C35H41N5.C7H6.2ClH.Ru/c1-24(2)28-12-9-13-29(25(3)4)34(28)39-20-18-37(22-39)32-16-11-17-33(36-32)38-19-21-40(23-38)35-30(26(5)6)14-10-15-31(35)27(7)8;1-7-5-3-2-4-6-7;;;/h9-21,24-27H,1-8H3;1-6H;2*1H;/q;;;;+2/p-2 |
| InChIKey | PWYNMFRHERUFSR-UHFFFAOYSA-L |
| XLogP | 11.93 |
| TPSA | 25.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 793.85 |
| LogP ≤ 5 | 11.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 15984603 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15984603?
The IUPAC name of CID 15984603 (CID 15984603) is not available.
What is the SMILES notation for CID 15984603?
The canonical SMILES for CID 15984603 is CC(C)c1cccc(C(C)C)c1N1[C]N(c2cccc(N3[C]N(c4c(C(C)C)cccc4C(C)C)C=C3)n2)C=C1.Cl[Ru](Cl)=Cc1ccccc1.
What is the InChIKey of CID 15984603?
The InChIKey is PWYNMFRHERUFSR-UHFFFAOYSA-L. The full InChI is InChI=1S/C35H41N5.C7H6.2ClH.Ru/c1-24(2)28-12-9-13-29(25(3)4)34(28)39-20-18-37(22-39)32-16-11-17-33(36-32)38-19-21-40(23-38)35-30(26(5)6)14-10-15-31(35)27(7)8;1-7-5-3-2-4-6-7;;;/h9-21,24-27H,1-8H3;1-6H;2*1H;/q;;;;+2/p-2.
What are the key properties of CID 15984603?
CID 15984603 has a molecular weight of 793.85 g/mol, XLogP of 11.93, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15984603 is sourced from PubChem (CID 15984603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).