C35H56O6Si — CID 15984615
CID 15984615 (PubChem CID 15984615) has the molecular formula C35H56O6Si and a molecular weight of 600.91 g/mol.
| Compound Name | CID 15984615 |
|---|---|
| PubChem CID | 15984615 |
| Molecular Formula | C35H56O6Si |
| Molecular Weight | 600.91 g/mol |
| Exact Mass | 600.38 |
| IUPAC Name | — |
| SMILES | C#CC[C@@H](C)[C@@H](OC(=O)[C@@H](C)[CH][CH][CH][CH2])[C@H](O[Si](CC)(CC)CC)[C@@H]1CC[C@H](CC/C=C/[C@H]2OC(C)(C)O[C@@H]2C=C)O1 |
| InChI | InChI=1S/C35H56O6Si/c1-11-17-21-27(8)34(36)38-32(26(7)20-12-2)33(41-42(14-4,15-5)16-6)31-25-24-28(37-31)22-18-19-23-30-29(13-3)39-35(9,10)40-30/h2,11,13,17,19,21,23,26-33H,1,3,14-16,18,20,22,24-25H2,4-10H3/b23-19+/t26-,27+,28+,29-,30-,31+,32-,33-/m1/s1 |
| InChIKey | ORLBZKPOVVSPTB-ZCJKGHOPSA-N |
| XLogP | 7.62 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.91 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|