About N,N-dibutylbut-3-enamide
N,N-dibutylbut-3-enamide (PubChem CID 15984652) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is N,N-dibutylbut-3-enamide.
Molecular Properties
| Compound Name | N,N-dibutylbut-3-enamide |
| PubChem CID | 15984652 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N,N-dibutylbut-3-enamide |
| SMILES | C=CCC(=O)N(CCCC)CCCC |
| InChI | InChI=1S/C12H23NO/c1-4-7-10-13(11-8-5-2)12(14)9-6-3/h6H,3-5,7-11H2,1-2H3 |
| InChIKey | DECBTWHNXADZBM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N,N-dibutylbut-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutylbut-3-enamide?
The IUPAC name of N,N-dibutylbut-3-enamide (CID 15984652) is N,N-dibutylbut-3-enamide.
What is the SMILES notation for N,N-dibutylbut-3-enamide?
The canonical SMILES for N,N-dibutylbut-3-enamide is C=CCC(=O)N(CCCC)CCCC.
What is the InChIKey of N,N-dibutylbut-3-enamide?
The InChIKey is DECBTWHNXADZBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-4-7-10-13(11-8-5-2)12(14)9-6-3/h6H,3-5,7-11H2,1-2H3.
What are the key properties of N,N-dibutylbut-3-enamide?
N,N-dibutylbut-3-enamide has a molecular weight of 197.32 g/mol, XLogP of 2.99, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutylbut-3-enamide is sourced from PubChem (CID 15984652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).