About 3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide
3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide (PubChem CID 15984656) has the molecular formula C17H17N2O4P
and a molecular weight of 344.31 g/mol. Its IUPAC name is 3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide.
Molecular Properties
| Compound Name | 3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide |
| PubChem CID | 15984656 |
| Molecular Formula | C17H17N2O4P |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide |
| SMILES | CP1(=O)OC(c2ccc([N+](=O)[O-])cc2)=CCN1Cc1ccccc1 |
| InChI | InChI=1S/C17H17N2O4P/c1-24(22)18(13-14-5-3-2-4-6-14)12-11-17(23-24)15-7-9-16(10-8-15)19(20)21/h2-11H,12-13H2,1H3 |
| InChIKey | HORSMXURLQIDPD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide?
The IUPAC name of 3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide (CID 15984656) is 3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide.
What is the SMILES notation for 3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide?
The canonical SMILES for 3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide is CP1(=O)OC(c2ccc([N+](=O)[O-])cc2)=CCN1Cc1ccccc1.
What is the InChIKey of 3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide?
The InChIKey is HORSMXURLQIDPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N2O4P/c1-24(22)18(13-14-5-3-2-4-6-14)12-11-17(23-24)15-7-9-16(10-8-15)19(20)21/h2-11H,12-13H2,1H3.
What are the key properties of 3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide?
3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide has a molecular weight of 344.31 g/mol, XLogP of 4.29, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-2-methyl-6-(4-nitrophenyl)-4H-1,3,2λ5-oxazaphosphinine 2-oxide is sourced from PubChem (CID 15984656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).