C25H39ClN4O4 — CID 15984686
(3S,5R)-5-(tert-butylcarbamoylamino)-N-[[4-chloro-3-(3-methoxypropoxy)phenyl]methyl]-N-cyclopropylpiperidine-3-carboxamide (PubChem CID 15984686) has the molecular formula C25H39ClN4O4 and a molecular weight of 495.06 g/mol. Its IUPAC name is (3S,5R)-5-(tert-butylcarbamoylamino)-N-[[4-chloro-3-(3-methoxypropoxy)phenyl]methyl]-N-cyclopropylpiperidine-3-carboxamide.
| Compound Name | (3S,5R)-5-(tert-butylcarbamoylamino)-N-[[4-chloro-3-(3-methoxypropoxy)phenyl]methyl]-N-cyclopropylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 15984686 |
| Molecular Formula | C25H39ClN4O4 |
| Molecular Weight | 495.06 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | (3S,5R)-5-(tert-butylcarbamoylamino)-N-[[4-chloro-3-(3-methoxypropoxy)phenyl]methyl]-N-cyclopropylpiperidine-3-carboxamide |
| SMILES | COCCCOc1cc(CN(C(=O)[C@@H]2CNC[C@H](NC(=O)NC(C)(C)C)C2)C2CC2)ccc1Cl |
| InChI | InChI=1S/C25H39ClN4O4/c1-25(2,3)29-24(32)28-19-13-18(14-27-15-19)23(31)30(20-7-8-20)16-17-6-9-21(26)22(12-17)34-11-5-10-33-4/h6,9,12,18-20,27H,5,7-8,10-11,13-16H2,1-4H3,(H2,28,29,32)/t18-,19+/m0/s1 |
| InChIKey | BJAYQQCYESNJOP-RBUKOAKNSA-N |
| XLogP | 3.32 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.06 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|