C15H30N2O4 — CID 159847437
tert-butyl 2,2,6,6-tetradeuterio-4-hydroxypiperidine-1-carboxylate;2,2,6,6-tetradeuteriopiperidin-4-ol (PubChem CID 159847437) has the molecular formula C15H30N2O4 and a molecular weight of 310.46 g/mol. Its IUPAC name is tert-butyl 2,2,6,6-tetradeuterio-4-hydroxypiperidine-1-carboxylate;2,2,6,6-tetradeuteriopiperidin-4-ol.
| Compound Name | tert-butyl 2,2,6,6-tetradeuterio-4-hydroxypiperidine-1-carboxylate;2,2,6,6-tetradeuteriopiperidin-4-ol |
|---|---|
| PubChem CID | 159847437 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 310.46 g/mol |
| Exact Mass | 310.27 |
| IUPAC Name | tert-butyl 2,2,6,6-tetradeuterio-4-hydroxypiperidine-1-carboxylate;2,2,6,6-tetradeuteriopiperidin-4-ol |
| SMILES | [2H]C1([2H])CC(O)CC([2H])([2H])N1.[2H]C1([2H])CC(O)CC([2H])([2H])N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19NO3.C5H11NO/c1-10(2,3)14-9(13)11-6-4-8(12)5-7-11;7-5-1-3-6-4-2-5/h8,12H,4-7H2,1-3H3;5-7H,1-4H2/i6D2,7D2;3D2,4D2 |
| InChIKey | NPMLAFCTRRQRJD-ACFXKSFKSA-N |
| XLogP | 1.11 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |