C32H32FN7O3 — CID 159848348
(Z)-1-[7-ethoxy-4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]quinazolin-6-yl]-3-fluoro-4-[(2S)-1-methylpyrrolidin-2-yl]but-3-en-2-one (PubChem CID 159848348) has the molecular formula C32H32FN7O3 and a molecular weight of 581.65 g/mol. Its IUPAC name is (Z)-1-[7-ethoxy-4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]quinazolin-6-yl]-3-fluoro-4-[(2S)-1-methylpyrrolidin-2-yl]but-3-en-2-one.
| Compound Name | (Z)-1-[7-ethoxy-4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]quinazolin-6-yl]-3-fluoro-4-[(2S)-1-methylpyrrolidin-2-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 159848348 |
| Molecular Formula | C32H32FN7O3 |
| Molecular Weight | 581.65 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | (Z)-1-[7-ethoxy-4-[3-methyl-4-([1,2,4]triazolo[1,5-a]pyridin-7-yloxy)anilino]quinazolin-6-yl]-3-fluoro-4-[(2S)-1-methylpyrrolidin-2-yl]but-3-en-2-one |
| SMILES | CCOc1cc2ncnc(Nc3ccc(Oc4ccn5ncnc5c4)c(C)c3)c2cc1CC(=O)/C(F)=C/[C@@H]1CCCN1C |
| InChI | InChI=1S/C32H32FN7O3/c1-4-42-30-17-27-25(13-21(30)14-28(41)26(33)15-23-6-5-10-39(23)3)32(36-18-34-27)38-22-7-8-29(20(2)12-22)43-24-9-11-40-31(16-24)35-19-37-40/h7-9,11-13,15-19,23H,4-6,10,14H2,1-3H3,(H,34,36,38)/b26-15-/t23-/m0/s1 |
| InChIKey | NPPHMUNQRJEWJD-VNAAUWNKSA-N |
| XLogP | 5.97 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|