About 4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol
4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol (PubChem CID 15984881) has the molecular formula C22H24Cl2N2O3
and a molecular weight of 435.35 g/mol. Its IUPAC name is 4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol.
Molecular Properties
| Compound Name | 4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol |
| PubChem CID | 15984881 |
| Molecular Formula | C22H24Cl2N2O3 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | 4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol |
| SMILES | CCc1nn(C(C)(C)C)c(Oc2c(Cl)cc(Oc3ccc(O)cc3)cc2Cl)c1C |
| InChI | InChI=1S/C22H24Cl2N2O3/c1-6-19-13(2)21(26(25-19)22(3,4)5)29-20-17(23)11-16(12-18(20)24)28-15-9-7-14(27)8-10-15/h7-12,27H,6H2,1-5H3 |
| InChIKey | AMDRFQILXLETAP-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol?
The IUPAC name of 4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol (CID 15984881) is 4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol.
What is the SMILES notation for 4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol?
The canonical SMILES for 4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol is CCc1nn(C(C)(C)C)c(Oc2c(Cl)cc(Oc3ccc(O)cc3)cc2Cl)c1C.
What is the InChIKey of 4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol?
The InChIKey is AMDRFQILXLETAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24Cl2N2O3/c1-6-19-13(2)21(26(25-19)22(3,4)5)29-20-17(23)11-16(12-18(20)24)28-15-9-7-14(27)8-10-15/h7-12,27H,6H2,1-5H3.
What are the key properties of 4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol?
4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol has a molecular weight of 435.35 g/mol, XLogP of 7.11, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-tert-butyl-5-ethyl-4-methylpyrazol-3-yl)oxy-3,5-dichlorophenoxy]phenol is sourced from PubChem (CID 15984881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).