About 2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate
2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate (PubChem CID 15984973) has the molecular formula C16H25ClO6Si
and a molecular weight of 376.91 g/mol. Its IUPAC name is 2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate.
Molecular Properties
| Compound Name | 2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate |
| PubChem CID | 15984973 |
| Molecular Formula | C16H25ClO6Si |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OCCCl)C(O[Si](C)(C)C(C)(C)C)C1=CC(=O)OC1O |
| InChI | InChI=1S/C16H25ClO6Si/c1-10(14(19)21-8-7-17)13(11-9-12(18)22-15(11)20)23-24(5,6)16(2,3)4/h9,13,15,20H,1,7-8H2,2-6H3 |
| InChIKey | RIXOHFOWXVPRJH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate?
The IUPAC name of 2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate (CID 15984973) is 2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate.
What is the SMILES notation for 2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate?
The canonical SMILES for 2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate is C=C(C(=O)OCCCl)C(O[Si](C)(C)C(C)(C)C)C1=CC(=O)OC1O.
What is the InChIKey of 2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate?
The InChIKey is RIXOHFOWXVPRJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25ClO6Si/c1-10(14(19)21-8-7-17)13(11-9-12(18)22-15(11)20)23-24(5,6)16(2,3)4/h9,13,15,20H,1,7-8H2,2-6H3.
What are the key properties of 2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate?
2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate has a molecular weight of 376.91 g/mol, XLogP of 2.52, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroethyl 2-[[tert-butyl(dimethyl)silyl]oxy-(2-hydroxy-5-oxo-2H-furan-3-yl)methyl]prop-2-enoate is sourced from PubChem (CID 15984973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).