About 2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide
2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide (PubChem CID 159849853) has the molecular formula C10H18FNO
and a molecular weight of 187.26 g/mol. Its IUPAC name is 2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide |
| PubChem CID | 159849853 |
| Molecular Formula | C10H18FNO |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide |
| SMILES | CN(C)C(=O)C(C)(F)C1CCCC1 |
| InChI | InChI=1S/C10H18FNO/c1-10(11,9(13)12(2)3)8-6-4-5-7-8/h8H,4-7H2,1-3H3 |
| InChIKey | OQMANMJHTQQEJN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide?
The IUPAC name of 2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide (CID 159849853) is 2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide.
What is the SMILES notation for 2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide?
The canonical SMILES for 2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide is CN(C)C(=O)C(C)(F)C1CCCC1.
What is the InChIKey of 2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide?
The InChIKey is OQMANMJHTQQEJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18FNO/c1-10(11,9(13)12(2)3)8-6-4-5-7-8/h8H,4-7H2,1-3H3.
What are the key properties of 2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide?
2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide has a molecular weight of 187.26 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-2-fluoro-N,N-dimethylpropanamide is sourced from PubChem (CID 159849853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).