C37H50N4O5 — CID 15985016
[1-[2-[[4-[[bis(2-ethoxyethyl)amino]methyl]benzoyl]-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate (PubChem CID 15985016) has the molecular formula C37H50N4O5 and a molecular weight of 630.83 g/mol. Its IUPAC name is [1-[2-[[4-[[bis(2-ethoxyethyl)amino]methyl]benzoyl]-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate.
| Compound Name | [1-[2-[[4-[[bis(2-ethoxyethyl)amino]methyl]benzoyl]-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
|---|---|
| PubChem CID | 15985016 |
| Molecular Formula | C37H50N4O5 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.38 |
| IUPAC Name | [1-[2-[[4-[[bis(2-ethoxyethyl)amino]methyl]benzoyl]-methylamino]ethyl]piperidin-4-yl] N-(2-phenylphenyl)carbamate |
| SMILES | CCOCCN(CCOCC)Cc1ccc(C(=O)N(C)CCN2CCC(OC(=O)Nc3ccccc3-c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C37H50N4O5/c1-4-44-27-25-41(26-28-45-5-2)29-30-15-17-32(18-16-30)36(42)39(3)23-24-40-21-19-33(20-22-40)46-37(43)38-35-14-10-9-13-34(35)31-11-7-6-8-12-31/h6-18,33H,4-5,19-29H2,1-3H3,(H,38,43) |
| InChIKey | PEZJFQDELHLNBY-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 83.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|