About bis(2,2-difluoroethyl) carbonate
bis(2,2-difluoroethyl) carbonate (PubChem CID 15985041) has the molecular formula C5H6F4O3
and a molecular weight of 190.09 g/mol. Its IUPAC name is bis(2,2-difluoroethyl) carbonate.
Molecular Properties
| Compound Name | bis(2,2-difluoroethyl) carbonate |
| PubChem CID | 15985041 |
| Molecular Formula | C5H6F4O3 |
| Molecular Weight | 190.09 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | bis(2,2-difluoroethyl) carbonate |
| SMILES | O=C(OCC(F)F)OCC(F)F |
| InChI | InChI=1S/C5H6F4O3/c6-3(7)1-11-5(10)12-2-4(8)9/h3-4H,1-2H2 |
| InChIKey | UYFISINJOLGYBJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.09 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis(2,2-difluoroethyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2,2-difluoroethyl) carbonate?
The IUPAC name of bis(2,2-difluoroethyl) carbonate (CID 15985041) is bis(2,2-difluoroethyl) carbonate.
What is the SMILES notation for bis(2,2-difluoroethyl) carbonate?
The canonical SMILES for bis(2,2-difluoroethyl) carbonate is O=C(OCC(F)F)OCC(F)F.
What is the InChIKey of bis(2,2-difluoroethyl) carbonate?
The InChIKey is UYFISINJOLGYBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6F4O3/c6-3(7)1-11-5(10)12-2-4(8)9/h3-4H,1-2H2.
What are the key properties of bis(2,2-difluoroethyl) carbonate?
bis(2,2-difluoroethyl) carbonate has a molecular weight of 190.09 g/mol, XLogP of 1.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2,2-difluoroethyl) carbonate is sourced from PubChem (CID 15985041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).